C54H32N8 — CID 158089522
2,3-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalene-1,4-dicarbonitrile (PubChem CID 158089522) has the molecular formula C54H32N8 and a molecular weight of 792.91 g/mol. Its IUPAC name is 2,3-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalene-1,4-dicarbonitrile.
| Compound Name | 2,3-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 158089522 |
| Molecular Formula | C54H32N8 |
| Molecular Weight | 792.91 g/mol |
| Exact Mass | 792.27 |
| IUPAC Name | 2,3-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalene-1,4-dicarbonitrile |
| SMILES | N#Cc1c(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(C#N)c2ccccc12 |
| InChI | InChI=1S/C54H32N8/c55-33-45-43-29-13-14-30-44(43)46(34-56)48(40-26-16-28-42(32-40)54-61-51(37-21-9-3-10-22-37)58-52(62-54)38-23-11-4-12-24-38)47(45)39-25-15-27-41(31-39)53-59-49(35-17-5-1-6-18-35)57-50(60-53)36-19-7-2-8-20-36/h1-32H |
| InChIKey | LKRBHOUKBOJGTK-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 124.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.91 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |