C24H13FO2 — CID 163600910
6-fluoro-1,3-diphenylcyclopenta[a]indene-2,4-dione (PubChem CID 163600910) has the molecular formula C24H13FO2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 6-fluoro-1,3-diphenylcyclopenta[a]indene-2,4-dione.
| Compound Name | 6-fluoro-1,3-diphenylcyclopenta[a]indene-2,4-dione |
|---|---|
| PubChem CID | 163600910 |
| Molecular Formula | C24H13FO2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 6-fluoro-1,3-diphenylcyclopenta[a]indene-2,4-dione |
| SMILES | O=c1c(-c2ccccc2)c2c(=O)c3cc(F)ccc3c-2c1-c1ccccc1 |
| InChI | InChI=1S/C24H13FO2/c25-16-11-12-17-18(13-16)23(26)22-20(15-9-5-2-6-10-15)24(27)19(21(17)22)14-7-3-1-4-8-14/h1-13H |
| InChIKey | GXNWYXZIIWNDRF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |