About 2-fluorotriphenylene
2-fluorotriphenylene (PubChem CID 23233895) has the molecular formula C18H11F
and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-fluorotriphenylene.
Molecular Properties
| Compound Name | 2-fluorotriphenylene |
| PubChem CID | 23233895 |
| Molecular Formula | C18H11F |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-fluorotriphenylene |
| SMILES | Fc1ccc2c3ccccc3c3ccccc3c2c1 |
| InChI | InChI=1S/C18H11F/c19-12-9-10-17-15-7-2-1-5-13(15)14-6-3-4-8-16(14)18(17)11-12/h1-11H |
| InChIKey | CIBKDGSKPMCRAT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorotriphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorotriphenylene?
The IUPAC name of 2-fluorotriphenylene (CID 23233895) is 2-fluorotriphenylene.
What is the SMILES notation for 2-fluorotriphenylene?
The canonical SMILES for 2-fluorotriphenylene is Fc1ccc2c3ccccc3c3ccccc3c2c1.
What is the InChIKey of 2-fluorotriphenylene?
The InChIKey is CIBKDGSKPMCRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F/c19-12-9-10-17-15-7-2-1-5-13(15)14-6-3-4-8-16(14)18(17)11-12/h1-11H.
What are the key properties of 2-fluorotriphenylene?
2-fluorotriphenylene has a molecular weight of 246.28 g/mol, XLogP of 5.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorotriphenylene is sourced from PubChem (CID 23233895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).