C26H14FNO2 — CID 102487100
5-fluoro-18-nitrohexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,5,8,10,12,15(20),16,18,21,23,25-tridecaene (PubChem CID 102487100) has the molecular formula C26H14FNO2 and a molecular weight of 391.40 g/mol. Its IUPAC name is 5-fluoro-18-nitrohexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,5,8,10,12,15(20),16,18,21,23,25-tridecaene.
| Compound Name | 5-fluoro-18-nitrohexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,5,8,10,12,15(20),16,18,21,23,25-tridecaene |
|---|---|
| PubChem CID | 102487100 |
| Molecular Formula | C26H14FNO2 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-fluoro-18-nitrohexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,5,8,10,12,15(20),16,18,21,23,25-tridecaene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c1ccccc1c1c3ccc(F)cc3c3ccccc3c21 |
| InChI | InChI=1S/C26H14FNO2/c27-15-9-11-21-23(13-15)17-5-1-3-7-19(17)26-22-12-10-16(28(29)30)14-24(22)18-6-2-4-8-20(18)25(21)26/h1-14H |
| InChIKey | UGPXQVBQKCOVMB-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|