C20H7NO6S — CID 118099401
6-nitro-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone (PubChem CID 118099401) has the molecular formula C20H7NO6S and a molecular weight of 389.34 g/mol. Its IUPAC name is 6-nitro-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone.
| Compound Name | 6-nitro-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone |
|---|---|
| PubChem CID | 118099401 |
| Molecular Formula | C20H7NO6S |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 6-nitro-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone |
| SMILES | O=c1c2ccccc2c(=O)c2c1sc1c(=O)c3ccc([N+](=O)[O-])cc3c(=O)c12 |
| InChI | InChI=1S/C20H7NO6S/c22-15-9-3-1-2-4-10(9)17(24)19-13(15)14-16(23)12-7-8(21(26)27)5-6-11(12)18(25)20(14)28-19/h1-7H |
| InChIKey | JVKYGFMDHLAXMU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|