C25H17FN+ — CID 71813207
9-fluoro-6,7-diphenylbenzo[a]quinolizin-5-ium (PubChem CID 71813207) has the molecular formula C25H17FN+ and a molecular weight of 350.42 g/mol. Its IUPAC name is 9-fluoro-6,7-diphenylbenzo[a]quinolizin-5-ium.
| Compound Name | 9-fluoro-6,7-diphenylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 71813207 |
| Molecular Formula | C25H17FN+ |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 9-fluoro-6,7-diphenylbenzo[a]quinolizin-5-ium |
| SMILES | Fc1ccc2c(c1)c(-c1ccccc1)c(-c1ccccc1)[n+]1ccccc21 |
| InChI | InChI=1S/C25H17FN/c26-20-14-15-21-22(17-20)24(18-9-3-1-4-10-18)25(19-11-5-2-6-12-19)27-16-8-7-13-23(21)27/h1-17H/q+1 |
| InChIKey | RJRDXWNUCIBGKP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|