C27H19BF4N2 — CID 162407908
8,9-diphenyl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene tetrafluoroborate (PubChem CID 162407908) has the molecular formula C27H19BF4N2 and a molecular weight of 458.27 g/mol. Its IUPAC name is 8,9-diphenyl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene tetrafluoroborate.
| Compound Name | 8,9-diphenyl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene tetrafluoroborate |
|---|---|
| PubChem CID | 162407908 |
| Molecular Formula | C27H19BF4N2 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 8,9-diphenyl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(-c2c(-c3ccccc3)[n+]3ccccc3n3c2cc2ccccc23)cc1 |
| InChI | InChI=1S/C27H19N2.BF4/c1-3-11-20(12-4-1)26-24-19-22-15-7-8-16-23(22)29(24)25-17-9-10-18-28(25)27(26)21-13-5-2-6-14-21;2-1(3,4)5/h1-19H;/q+1;-1 |
| InChIKey | JDICQFGVPKJNTO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 8.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|