C23H15N2S2+ — CID 162407916
8,9-dithiophen-2-yl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene (PubChem CID 162407916) has the molecular formula C23H15N2S2+ and a molecular weight of 383.52 g/mol. Its IUPAC name is 8,9-dithiophen-2-yl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene.
| Compound Name | 8,9-dithiophen-2-yl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene |
|---|---|
| PubChem CID | 162407916 |
| Molecular Formula | C23H15N2S2+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 8,9-dithiophen-2-yl-1-aza-7-azoniatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene |
| SMILES | c1csc(-c2c(-c3cccs3)[n+]3ccccc3n3c2cc2ccccc23)c1 |
| InChI | InChI=1S/C23H15N2S2/c1-2-8-17-16(7-1)15-18-22(19-9-5-13-26-19)23(20-10-6-14-27-20)24-12-4-3-11-21(24)25(17)18/h1-15H/q+1 |
| InChIKey | OABOWRZPIYXXQI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 8.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|