C22H17NO2 — CID 54705737
14-hydroxy-15-phenyl-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,8,13(17),14-hexaen-16-one (PubChem CID 54705737) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 14-hydroxy-15-phenyl-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,8,13(17),14-hexaen-16-one.
| Compound Name | 14-hydroxy-15-phenyl-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,8,13(17),14-hexaen-16-one |
|---|---|
| PubChem CID | 54705737 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 14-hydroxy-15-phenyl-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,8,13(17),14-hexaen-16-one |
| SMILES | O=c1c(-c2ccccc2)c(O)c2c3c(cc4ccccc4n13)CCC2 |
| InChI | InChI=1S/C22H17NO2/c24-21-17-11-6-10-16-13-15-9-4-5-12-18(15)23(20(16)17)22(25)19(21)14-7-2-1-3-8-14/h1-5,7-9,12-13,24H,6,10-11H2 |
| InChIKey | RLMIRIXGCWXQJE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|