About 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile
5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 3686140) has the molecular formula C9H9BrN2O
and a molecular weight of 241.09 g/mol. Its IUPAC name is 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile.
Analyze 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile?
The IUPAC name of 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile (CID 3686140) is 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile.
What is the SMILES notation for 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile?
The canonical SMILES for 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile is COc1c(Br)c(C)nc(C)c1C#N.
What is the InChIKey of 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile?
The InChIKey is LYDPLUJDUXCFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O/c1-5-7(4-11)9(13-3)8(10)6(2)12-5/h1-3H3.
What are the key properties of 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile?
5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile has a molecular weight of 241.09 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-methoxy-2,6-dimethylpyridine-3-carbonitrile is sourced from PubChem (CID 3686140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).