C6H6N2O2 — CID 82651130
5-methoxy-3-methyl-1,2-oxazole-4-carbonitrile (PubChem CID 82651130) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 5-methoxy-3-methyl-1,2-oxazole-4-carbonitrile.
| Compound Name | 5-methoxy-3-methyl-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 82651130 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 5-methoxy-3-methyl-1,2-oxazole-4-carbonitrile |
| SMILES | COc1onc(C)c1C#N |
| InChI | InChI=1S/C6H6N2O2/c1-4-5(3-7)6(9-2)10-8-4/h1-2H3 |
| InChIKey | XGSSJTNZIQPCIG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |