C12H8ClN3O2 — CID 4318316
2-chloro-N-(4-cyano-3-methyl-1,2-oxazol-5-yl)benzamide (PubChem CID 4318316) has the molecular formula C12H8ClN3O2 and a molecular weight of 261.67 g/mol. Its IUPAC name is 2-chloro-N-(4-cyano-3-methyl-1,2-oxazol-5-yl)benzamide.
| Compound Name | 2-chloro-N-(4-cyano-3-methyl-1,2-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 4318316 |
| Molecular Formula | C12H8ClN3O2 |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-chloro-N-(4-cyano-3-methyl-1,2-oxazol-5-yl)benzamide |
| SMILES | Cc1noc(NC(=O)c2ccccc2Cl)c1C#N |
| InChI | InChI=1S/C12H8ClN3O2/c1-7-9(6-14)12(18-16-7)15-11(17)8-4-2-3-5-10(8)13/h2-5H,1H3,(H,15,17) |
| InChIKey | SSVQOGCTKMVLCP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |