C12H9N3O3 — CID 67363494
(4-cyano-3-methyl-1,2-oxazol-5-yl) N-phenylcarbamate (PubChem CID 67363494) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is (4-cyano-3-methyl-1,2-oxazol-5-yl) N-phenylcarbamate.
| Compound Name | (4-cyano-3-methyl-1,2-oxazol-5-yl) N-phenylcarbamate |
|---|---|
| PubChem CID | 67363494 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (4-cyano-3-methyl-1,2-oxazol-5-yl) N-phenylcarbamate |
| SMILES | Cc1noc(OC(=O)Nc2ccccc2)c1C#N |
| InChI | InChI=1S/C12H9N3O3/c1-8-10(7-13)11(18-15-8)17-12(16)14-9-5-3-2-4-6-9/h2-6H,1H3,(H,14,16) |
| InChIKey | RPDBQPWKPWDMME-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |