C16H10Cl2N2O2 — CID 20546757
2-chloro-N-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]benzamide (PubChem CID 20546757) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 2-chloro-N-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]benzamide.
| Compound Name | 2-chloro-N-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 20546757 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-chloro-N-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]benzamide |
| SMILES | O=C(Nc1cc(-c2ccc(Cl)cc2)on1)c1ccccc1Cl |
| InChI | InChI=1S/C16H10Cl2N2O2/c17-11-7-5-10(6-8-11)14-9-15(20-22-14)19-16(21)12-3-1-2-4-13(12)18/h1-9H,(H,19,20,21) |
| InChIKey | LSAIBUFVVSQKFM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |