C15H11ClN2O4 — CID 108757254
methyl 5-[(2-chlorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate (PubChem CID 108757254) has the molecular formula C15H11ClN2O4 and a molecular weight of 318.72 g/mol. Its IUPAC name is methyl 5-[(2-chlorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(2-chlorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108757254 |
| Molecular Formula | C15H11ClN2O4 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | methyl 5-[(2-chlorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)c2ccccc2Cl)c1C#N |
| InChI | InChI=1S/C15H11ClN2O4/c1-8-12(15(20)21-2)10(7-17)14(22-8)18-13(19)9-5-3-4-6-11(9)16/h3-6H,1-2H3,(H,18,19) |
| InChIKey | HMJCNSJSUAZIOA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |