C15H10ClFN2O4 — CID 108733932
methyl 5-[(2-chloro-6-fluorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate (PubChem CID 108733932) has the molecular formula C15H10ClFN2O4 and a molecular weight of 336.71 g/mol. Its IUPAC name is methyl 5-[(2-chloro-6-fluorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(2-chloro-6-fluorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108733932 |
| Molecular Formula | C15H10ClFN2O4 |
| Molecular Weight | 336.71 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | methyl 5-[(2-chloro-6-fluorobenzoyl)amino]-4-cyano-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)c2c(F)cccc2Cl)c1C#N |
| InChI | InChI=1S/C15H10ClFN2O4/c1-7-11(15(21)22-2)8(6-18)14(23-7)19-13(20)12-9(16)4-3-5-10(12)17/h3-5H,1-2H3,(H,19,20) |
| InChIKey | LNILCYHSXKFOLY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |