C4H3N3O2 — CID 82418880
4-methoxy-1,2,5-oxadiazole-3-carbonitrile (PubChem CID 82418880) has the molecular formula C4H3N3O2 and a molecular weight of 125.09 g/mol. Its IUPAC name is 4-methoxy-1,2,5-oxadiazole-3-carbonitrile.
| Compound Name | 4-methoxy-1,2,5-oxadiazole-3-carbonitrile |
|---|---|
| PubChem CID | 82418880 |
| Molecular Formula | C4H3N3O2 |
| Molecular Weight | 125.09 g/mol |
| Exact Mass | 125.02 |
| IUPAC Name | 4-methoxy-1,2,5-oxadiazole-3-carbonitrile |
| SMILES | COc1nonc1C#N |
| InChI | InChI=1S/C4H3N3O2/c1-8-4-3(2-5)6-9-7-4/h1H3 |
| InChIKey | NKLVXCBIZOYHQR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.09 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |