C9H6N2O2 — CID 82411525
6-methoxyfuro[2,3-b]pyridine-5-carbonitrile (PubChem CID 82411525) has the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. Its IUPAC name is 6-methoxyfuro[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 6-methoxyfuro[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 82411525 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 6-methoxyfuro[2,3-b]pyridine-5-carbonitrile |
| SMILES | COc1nc2occc2cc1C#N |
| InChI | InChI=1S/C9H6N2O2/c1-12-8-7(5-10)4-6-2-3-13-9(6)11-8/h2-4H,1H3 |
| InChIKey | GNIMRRATVVIRRX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |