About 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile
6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile (PubChem CID 82403526) has the molecular formula C8H5N3OS
and a molecular weight of 191.21 g/mol. Its IUPAC name is 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile.
Analyze 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile?
The IUPAC name of 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile (CID 82403526) is 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile.
What is the SMILES notation for 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile?
The canonical SMILES for 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile is COc1nc2sncc2cc1C#N.
What is the InChIKey of 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile?
The InChIKey is XASBFQYVJBEGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3OS/c1-12-7-5(3-9)2-6-4-10-13-8(6)11-7/h2,4H,1H3.
What are the key properties of 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile?
6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile has a molecular weight of 191.21 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-[1,2]thiazolo[5,4-b]pyridine-5-carbonitrile is sourced from PubChem (CID 82403526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).