C4H6N2O2 — CID 23261248
3-methoxy-4-methyl-1,2,5-oxadiazole (PubChem CID 23261248) has the molecular formula C4H6N2O2 and a molecular weight of 114.10 g/mol. Its IUPAC name is 3-methoxy-4-methyl-1,2,5-oxadiazole.
| Compound Name | 3-methoxy-4-methyl-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 23261248 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 3-methoxy-4-methyl-1,2,5-oxadiazole |
| SMILES | COc1nonc1C |
| InChI | InChI=1S/C4H6N2O2/c1-3-4(7-2)6-8-5-3/h1-2H3 |
| InChIKey | NBJSKPRTMMQTDF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |