C7H11NO2 — CID 122546056
4-ethyl-3-methoxy-5-methyl-1,2-oxazole (PubChem CID 122546056) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-ethyl-3-methoxy-5-methyl-1,2-oxazole.
| Compound Name | 4-ethyl-3-methoxy-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 122546056 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 4-ethyl-3-methoxy-5-methyl-1,2-oxazole |
| SMILES | CCc1c(OC)noc1C |
| InChI | InChI=1S/C7H11NO2/c1-4-6-5(2)10-8-7(6)9-3/h4H2,1-3H3 |
| InChIKey | ZJRLBHMXXGPURC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |