C6H9NOS — CID 2507881
(3,5-dimethyl-1,2-oxazol-4-yl)methanethiol (PubChem CID 2507881) has the molecular formula C6H9NOS and a molecular weight of 143.21 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methanethiol.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methanethiol |
|---|---|
| PubChem CID | 2507881 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methanethiol |
| SMILES | Cc1noc(C)c1CS |
| InChI | InChI=1S/C6H9NOS/c1-4-6(3-9)5(2)8-7-4/h9H,3H2,1-2H3 |
| InChIKey | XWMCJLFTATZHEX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|