C6H8Cl2NO- — CID 22500933
4-(chloromethyl)-3,5-dimethyl-1,2-oxazole chloride (PubChem CID 22500933) has the molecular formula C6H8Cl2NO- and a molecular weight of 181.04 g/mol. Its IUPAC name is 4-(chloromethyl)-3,5-dimethyl-1,2-oxazole chloride.
| Compound Name | 4-(chloromethyl)-3,5-dimethyl-1,2-oxazole chloride |
|---|---|
| PubChem CID | 22500933 |
| Molecular Formula | C6H8Cl2NO- |
| Molecular Weight | 181.04 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 4-(chloromethyl)-3,5-dimethyl-1,2-oxazole chloride |
| SMILES | Cc1noc(C)c1CCl.[Cl-] |
| InChI | InChI=1S/C6H8ClNO.ClH/c1-4-6(3-7)5(2)9-8-4;/h3H2,1-2H3;1H/p-1 |
| InChIKey | IGRSRHOUFGYUGB-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.04 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|