C5H7N3O3 — CID 142341950
(NE)-N-[1-(4-methoxy-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine (PubChem CID 142341950) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is (NE)-N-[1-(4-methoxy-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(4-methoxy-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 142341950 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | (NE)-N-[1-(4-methoxy-1,2,5-oxadiazol-3-yl)ethylidene]hydroxylamine |
| SMILES | COc1nonc1/C(C)=N/O |
| InChI | InChI=1S/C5H7N3O3/c1-3(6-9)4-5(10-2)8-11-7-4/h9H,1-2H3/b6-3+ |
| InChIKey | GSXJRWQEOWVABU-ZZXKWVIFSA-N |
| XLogP | 0.28 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|