C6H7N7O2 — CID 135600943
(NZ)-N-[1-[2-(4-methyl-1,2,5-oxadiazol-3-yl)tetrazol-5-yl]ethylidene]hydroxylamine (PubChem CID 135600943) has the molecular formula C6H7N7O2 and a molecular weight of 209.17 g/mol. Its IUPAC name is (NZ)-N-[1-[2-(4-methyl-1,2,5-oxadiazol-3-yl)tetrazol-5-yl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[2-(4-methyl-1,2,5-oxadiazol-3-yl)tetrazol-5-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 135600943 |
| Molecular Formula | C6H7N7O2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (NZ)-N-[1-[2-(4-methyl-1,2,5-oxadiazol-3-yl)tetrazol-5-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1nnn(-c2nonc2C)n1 |
| InChI | InChI=1S/C6H7N7O2/c1-3(9-14)5-7-12-13(8-5)6-4(2)10-15-11-6/h14H,1-2H3/b9-3- |
| InChIKey | VYXQKUBLZAGREZ-OQFOIZHKSA-N |
| XLogP | -0.45 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|