C15H16N8O2 — CID 136861420
4-[(Z)-N-[(Z)-1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]-C-methylcarbonimidoyl]phenol (PubChem CID 136861420) has the molecular formula C15H16N8O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 4-[(Z)-N-[(Z)-1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]-C-methylcarbonimidoyl]phenol.
| Compound Name | 4-[(Z)-N-[(Z)-1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]-C-methylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 136861420 |
| Molecular Formula | C15H16N8O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-[(Z)-N-[(Z)-1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]-C-methylcarbonimidoyl]phenol |
| SMILES | C/C(=N/N=C(/C)c1nnn(-c2nonc2N)c1C)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16N8O2/c1-8(11-4-6-12(24)7-5-11)17-18-9(2)13-10(3)23(22-19-13)15-14(16)20-25-21-15/h4-7,24H,1-3H3,(H2,16,20)/b17-8-,18-9- |
| InChIKey | CKERCFRUQDUGGM-PEMJCMRISA-N |
| XLogP | 1.48 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|