C15H16N8O3 — CID 135688455
4-[(E)-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylidenehydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135688455) has the molecular formula C15H16N8O3 and a molecular weight of 356.35 g/mol. Its IUPAC name is 4-[(E)-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylidenehydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylidenehydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135688455 |
| Molecular Formula | C15H16N8O3 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-[(E)-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylidenehydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/N=C(C)c2nnn(-c3nonc3N)c2C)ccc1O |
| InChI | InChI=1S/C15H16N8O3/c1-8(18-17-7-10-4-5-11(24)12(6-10)25-3)13-9(2)23(22-19-13)15-14(16)20-26-21-15/h4-7,24H,1-3H3,(H2,16,20)/b17-7+,18-8? |
| InChIKey | PDCGBHGFIODKMY-XXNMAHGMSA-N |
| XLogP | 1.10 |
| TPSA | 149.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|