C17H17N9O4S2 — CID 136820440
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]triazole-4-carboxamide (PubChem CID 136820440) has the molecular formula C17H17N9O4S2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 136820440 |
| Molecular Formula | C17H17N9O4S2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]triazole-4-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2CSC2=NCCS2)ccc1O |
| InChI | InChI=1S/C17H17N9O4S2/c1-29-12-6-9(2-3-11(12)27)7-20-22-16(28)13-10(8-32-17-19-4-5-31-17)26(25-21-13)15-14(18)23-30-24-15/h2-3,6-7,27H,4-5,8H2,1H3,(H2,18,23)(H,22,28)/b20-7- |
| InChIKey | ZCNANHNVIWSCGR-SCDVKCJHSA-N |
| XLogP | 1.05 |
| TPSA | 178.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|