C25H22ClN9O5S2 — CID 6253353
[4-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate (PubChem CID 6253353) has the molecular formula C25H22ClN9O5S2 and a molecular weight of 628.10 g/mol. Its IUPAC name is [4-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6253353 |
| Molecular Formula | C25H22ClN9O5S2 |
| Molecular Weight | 628.10 g/mol |
| Exact Mass | 627.09 |
| IUPAC Name | [4-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-chlorobenzoate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2nnn(-c3nonc3N)c2CSC2=NCCS2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClN9O5S2/c1-2-38-19-11-14(3-8-18(19)39-24(37)15-4-6-16(26)7-5-15)12-29-31-23(36)20-17(13-42-25-28-9-10-41-25)35(34-30-20)22-21(27)32-40-33-22/h3-8,11-12H,2,9-10,13H2,1H3,(H2,27,32)(H,31,36)/b29-12- |
| InChIKey | PDNSMFPGJPNWFM-ULPWCQAASA-N |
| XLogP | 3.60 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.10 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|