C20H15ClN8O4S — CID 6046159
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-5-[(4-chlorophenyl)sulfanylmethyl]triazole-4-carboxamide (PubChem CID 6046159) has the molecular formula C20H15ClN8O4S and a molecular weight of 498.91 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-5-[(4-chlorophenyl)sulfanylmethyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-5-[(4-chlorophenyl)sulfanylmethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6046159 |
| Molecular Formula | C20H15ClN8O4S |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-5-[(4-chlorophenyl)sulfanylmethyl]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C\c2ccc3c(c2)OCO3)c1CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN8O4S/c21-12-2-4-13(5-3-12)34-9-14-17(24-28-29(14)19-18(22)26-33-27-19)20(30)25-23-8-11-1-6-15-16(7-11)32-10-31-15/h1-8H,9-10H2,(H2,22,26)(H,25,30)/b23-8- |
| InChIKey | IZOYFTIHOFHQMO-NYAPKIOYSA-N |
| XLogP | 2.67 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|