C21H21N11O3S4 — CID 4538870
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[[4-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]triazole-4-carboxamide (PubChem CID 4538870) has the molecular formula C21H21N11O3S4 and a molecular weight of 603.74 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[[4-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[[4-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 4538870 |
| Molecular Formula | C21H21N11O3S4 |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[[4-methoxy-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]triazole-4-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2nnn(-c3nonc3N)c2CSC2=NCCS2)cc1CSc1nnc(C)s1 |
| InChI | InChI=1S/C21H21N11O3S4/c1-11-25-28-21(39-11)37-9-13-7-12(3-4-15(13)34-2)8-24-27-19(33)16-14(10-38-20-23-5-6-36-20)32(31-26-16)18-17(22)29-35-30-18/h3-4,7-8H,5-6,9-10H2,1-2H3,(H2,22,29)(H,27,33) |
| InChIKey | FPEBOWFSDGQHSP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|