C24H22N8O — CID 3583986
4-[4-[N-(1,5-diphenylpenta-1,4-dien-3-ylideneamino)-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 3583986) has the molecular formula C24H22N8O and a molecular weight of 438.50 g/mol. Its IUPAC name is 4-[4-[N-(1,5-diphenylpenta-1,4-dien-3-ylideneamino)-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[4-[N-(1,5-diphenylpenta-1,4-dien-3-ylideneamino)-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 3583986 |
| Molecular Formula | C24H22N8O |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 4-[4-[N-(1,5-diphenylpenta-1,4-dien-3-ylideneamino)-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CC(=NN=C(C=Cc1ccccc1)C=Cc1ccccc1)c1nnn(-c2nonc2N)c1C |
| InChI | InChI=1S/C24H22N8O/c1-17(22-18(2)32(31-28-22)24-23(25)29-33-30-24)26-27-21(15-13-19-9-5-3-6-10-19)16-14-20-11-7-4-8-12-20/h3-16H,1-2H3,(H2,25,29) |
| InChIKey | KYCVOZMSIBKDIW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|