C13H13N9O2 — CID 4672585
N-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]pyridine-3-carboxamide (PubChem CID 4672585) has the molecular formula C13H13N9O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is N-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4672585 |
| Molecular Formula | C13H13N9O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[1-[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyltriazol-4-yl]ethylideneamino]pyridine-3-carboxamide |
| SMILES | CC(=NNC(=O)c1cccnc1)c1nnn(-c2nonc2N)c1C |
| InChI | InChI=1S/C13H13N9O2/c1-7(16-18-13(23)9-4-3-5-15-6-9)10-8(2)22(21-17-10)12-11(14)19-24-20-12/h3-6H,1-2H3,(H2,14,19)(H,18,23) |
| InChIKey | SIEVSHLBDITTKF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|