C12H18N8O2 — CID 3663367
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyl-N-(4-methylpentan-2-ylideneamino)triazole-4-carboxamide (PubChem CID 3663367) has the molecular formula C12H18N8O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyl-N-(4-methylpentan-2-ylideneamino)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyl-N-(4-methylpentan-2-ylideneamino)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3663367 |
| Molecular Formula | C12H18N8O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-methyl-N-(4-methylpentan-2-ylideneamino)triazole-4-carboxamide |
| SMILES | CC(CC(C)C)=NNC(=O)c1nnn(-c2nonc2N)c1C |
| InChI | InChI=1S/C12H18N8O2/c1-6(2)5-7(3)14-16-12(21)9-8(4)20(19-15-9)11-10(13)17-22-18-11/h6H,5H2,1-4H3,(H2,13,17)(H,16,21) |
| InChIKey | FCEOKZQZVSEIPK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|