C14H13FN8O — CID 691740
4-[4-[N-[(3-fluorophenyl)methylideneamino]-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 691740) has the molecular formula C14H13FN8O and a molecular weight of 328.31 g/mol. Its IUPAC name is 4-[4-[N-[(3-fluorophenyl)methylideneamino]-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[4-[N-[(3-fluorophenyl)methylideneamino]-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 691740 |
| Molecular Formula | C14H13FN8O |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[4-[N-[(3-fluorophenyl)methylideneamino]-C-methylcarbonimidoyl]-5-methyltriazol-1-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CC(=NN=Cc1cccc(F)c1)c1nnn(-c2nonc2N)c1C |
| InChI | InChI=1S/C14H13FN8O/c1-8(18-17-7-10-4-3-5-11(15)6-10)12-9(2)23(22-19-12)14-13(16)20-24-21-14/h3-7H,1-2H3,(H2,16,20) |
| InChIKey | LLYVNGBCLKJNPE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|