C19H14FN9O4 — CID 46495264
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-fluorophenyl)methylideneamino]-5-[(4-nitrophenyl)methyl]triazole-4-carboxamide (PubChem CID 46495264) has the molecular formula C19H14FN9O4 and a molecular weight of 451.38 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-fluorophenyl)methylideneamino]-5-[(4-nitrophenyl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-fluorophenyl)methylideneamino]-5-[(4-nitrophenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 46495264 |
| Molecular Formula | C19H14FN9O4 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-fluorophenyl)methylideneamino]-5-[(4-nitrophenyl)methyl]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C/c2cccc(F)c2)c1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14FN9O4/c20-13-3-1-2-12(8-13)10-22-24-19(30)16-15(9-11-4-6-14(7-5-11)29(31)32)28(27-23-16)18-17(21)25-33-26-18/h1-8,10H,9H2,(H2,21,25)(H,24,30)/b22-10+ |
| InChIKey | ZUNQHSAIFUZLBL-LSHDLFTRSA-N |
| XLogP | 1.63 |
| TPSA | 180.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|