C7H11N3O — CID 136983537
(NE)-N-[1-(1,5-dimethylpyrazol-3-yl)ethylidene]hydroxylamine (PubChem CID 136983537) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is (NE)-N-[1-(1,5-dimethylpyrazol-3-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(1,5-dimethylpyrazol-3-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 136983537 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | (NE)-N-[1-(1,5-dimethylpyrazol-3-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1cc(C)n(C)n1 |
| InChI | InChI=1S/C7H11N3O/c1-5-4-7(6(2)9-11)8-10(5)3/h4,11H,1-3H3/b9-6+ |
| InChIKey | QKCOLKSNRLGPBZ-RMKNXTFCSA-N |
| XLogP | 0.93 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|