About N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide
N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 130485672) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide |
| PubChem CID | 130485672 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(N)=O)nn1C |
| InChI | InChI=1S/C7H10N4O2/c1-4-3-5(10-11(4)2)6(12)9-7(8)13/h3H,1-2H3,(H3,8,9,12,13) |
| InChIKey | ZRBNCBJMPKVLBI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide?
The IUPAC name of N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide (CID 130485672) is N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide.
What is the SMILES notation for N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide?
The canonical SMILES for N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide is Cc1cc(C(=O)NC(N)=O)nn1C.
What is the InChIKey of N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide?
The InChIKey is ZRBNCBJMPKVLBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c1-4-3-5(10-11(4)2)6(12)9-7(8)13/h3H,1-2H3,(H3,8,9,12,13).
What are the key properties of N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide?
N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide has a molecular weight of 182.18 g/mol, XLogP of -0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyl-1,5-dimethylpyrazole-3-carboxamide is sourced from PubChem (CID 130485672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).