C14H18N4O — CID 110685819
N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 110685819) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110685819 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N(C)C)cc2)nn1C |
| InChI | InChI=1S/C14H18N4O/c1-10-9-13(16-18(10)4)14(19)15-11-5-7-12(8-6-11)17(2)3/h5-9H,1-4H3,(H,15,19) |
| InChIKey | PTIXEXVTDYUAKH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|