C13H14N4OS — CID 174530677
1,5-dimethyl-N-(phenylcarbamothioyl)pyrazole-3-carboxamide (PubChem CID 174530677) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 1,5-dimethyl-N-(phenylcarbamothioyl)pyrazole-3-carboxamide.
| Compound Name | 1,5-dimethyl-N-(phenylcarbamothioyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 174530677 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1,5-dimethyl-N-(phenylcarbamothioyl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(=S)Nc2ccccc2)nn1C |
| InChI | InChI=1S/C13H14N4OS/c1-9-8-11(16-17(9)2)12(18)15-13(19)14-10-6-4-3-5-7-10/h3-8H,1-2H3,(H2,14,15,18,19) |
| InChIKey | DOWYKHIXHGBQHH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|