About 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride
1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride (PubChem CID 159984372) has the molecular formula C7H11FN2O
and a molecular weight of 158.18 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride.
Analyze 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride?
The IUPAC name of 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride (CID 159984372) is 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride.
What is the SMILES notation for 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride?
The canonical SMILES for 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride is CC(=O)c1cc(C)n(C)n1.F.
What is the InChIKey of 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride?
The InChIKey is OGDKWTKTICCMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.FH/c1-5-4-7(6(2)10)8-9(5)3;/h4H,1-3H3;1H.
What are the key properties of 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride?
1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride has a molecular weight of 158.18 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,5-dimethylpyrazol-3-yl)ethanone;hydrofluoride is sourced from PubChem (CID 159984372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).