C10H16N2O2 — CID 130485579
tert-butyl 1,5-dimethylpyrazole-3-carboxylate (PubChem CID 130485579) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is tert-butyl 1,5-dimethylpyrazole-3-carboxylate.
| Compound Name | tert-butyl 1,5-dimethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 130485579 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | tert-butyl 1,5-dimethylpyrazole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OC(C)(C)C)nn1C |
| InChI | InChI=1S/C10H16N2O2/c1-7-6-8(11-12(7)5)9(13)14-10(2,3)4/h6H,1-5H3 |
| InChIKey | GKQKCDZLIDKSCI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |