tert-butyl 1,5-dimethylpyrazole-3-carboxylate

C10H16N2O2 — CID 130485579

IUPACtert-butyl 1,5-dimethylpyrazole-3-carboxylate
SMILESCc1cc(C(=O)OC(C)(C)C)nn1C
InChIInChI=1S/C10H16N2O2/c1-7-6-8(11-12(7)5)9(13)14-10(2,3)4/h6H,1-5H3
InChIKeyGKQKCDZLIDKSCI-UHFFFAOYSA-N
MW196.25 g/mol
LogP1.68
Rot. Bonds1

About tert-butyl 1,5-dimethylpyrazole-3-carboxylate

tert-butyl 1,5-dimethylpyrazole-3-carboxylate (PubChem CID 130485579) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is tert-butyl 1,5-dimethylpyrazole-3-carboxylate.

Molecular Properties

Compound Nametert-butyl 1,5-dimethylpyrazole-3-carboxylate
PubChem CID130485579
Molecular FormulaC10H16N2O2
Molecular Weight196.25 g/mol
Exact Mass196.12
IUPAC Nametert-butyl 1,5-dimethylpyrazole-3-carboxylate
SMILESCc1cc(C(=O)OC(C)(C)C)nn1C
InChIInChI=1S/C10H16N2O2/c1-7-6-8(11-12(7)5)9(13)14-10(2,3)4/h6H,1-5H3
InChIKeyGKQKCDZLIDKSCI-UHFFFAOYSA-N
XLogP1.68
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.25
LogP ≤ 51.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze tert-butyl 1,5-dimethylpyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 1,5-dimethylpyrazole-3-carboxylate?
The IUPAC name of tert-butyl 1,5-dimethylpyrazole-3-carboxylate (CID 130485579) is tert-butyl 1,5-dimethylpyrazole-3-carboxylate.
What is the SMILES notation for tert-butyl 1,5-dimethylpyrazole-3-carboxylate?
The canonical SMILES for tert-butyl 1,5-dimethylpyrazole-3-carboxylate is Cc1cc(C(=O)OC(C)(C)C)nn1C.
What is the InChIKey of tert-butyl 1,5-dimethylpyrazole-3-carboxylate?
The InChIKey is GKQKCDZLIDKSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-7-6-8(11-12(7)5)9(13)14-10(2,3)4/h6H,1-5H3.
What are the key properties of tert-butyl 1,5-dimethylpyrazole-3-carboxylate?
tert-butyl 1,5-dimethylpyrazole-3-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1,5-dimethylpyrazole-3-carboxylate is sourced from PubChem (CID 130485579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).