C10H16N2O — CID 126974372
1-(1,5-dimethylpyrazol-3-yl)-3-methylbutan-1-one (PubChem CID 126974372) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-3-yl)-3-methylbutan-1-one.
| Compound Name | 1-(1,5-dimethylpyrazol-3-yl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 126974372 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-3-yl)-3-methylbutan-1-one |
| SMILES | Cc1cc(C(=O)CC(C)C)nn1C |
| InChI | InChI=1S/C10H16N2O/c1-7(2)5-10(13)9-6-8(3)12(4)11-9/h6-7H,5H2,1-4H3 |
| InChIKey | UAHXUPMYMZVSPJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |