C15H25N3O4 — CID 174755008
azane;ditert-butyl 6-methylpyrimidine-2,4-dicarboxylate (PubChem CID 174755008) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is azane;ditert-butyl 6-methylpyrimidine-2,4-dicarboxylate.
| Compound Name | azane;ditert-butyl 6-methylpyrimidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 174755008 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | azane;ditert-butyl 6-methylpyrimidine-2,4-dicarboxylate |
| SMILES | Cc1cc(C(=O)OC(C)(C)C)nc(C(=O)OC(C)(C)C)n1.N |
| InChI | InChI=1S/C15H22N2O4.H3N/c1-9-8-10(12(18)20-14(2,3)4)17-11(16-9)13(19)21-15(5,6)7;/h8H,1-7H3;1H3 |
| InChIKey | ZTOXKVIDQLZDNU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |