C20H24N2O4 — CID 130276187
ditert-butyl 4-pyridin-4-ylpyridine-2,6-dicarboxylate (PubChem CID 130276187) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is ditert-butyl 4-pyridin-4-ylpyridine-2,6-dicarboxylate.
| Compound Name | ditert-butyl 4-pyridin-4-ylpyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 130276187 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | ditert-butyl 4-pyridin-4-ylpyridine-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(-c2ccncc2)cc(C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C20H24N2O4/c1-19(2,3)25-17(23)15-11-14(13-7-9-21-10-8-13)12-16(22-15)18(24)26-20(4,5)6/h7-12H,1-6H3 |
| InChIKey | WOHIVWYZRAIZQT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |