C15H20BrNO4 — CID 134117117
ditert-butyl 3-bromopyridine-2,6-dicarboxylate (PubChem CID 134117117) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is ditert-butyl 3-bromopyridine-2,6-dicarboxylate.
| Compound Name | ditert-butyl 3-bromopyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 134117117 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | ditert-butyl 3-bromopyridine-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Br)c(C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H20BrNO4/c1-14(2,3)20-12(18)10-8-7-9(16)11(17-10)13(19)21-15(4,5)6/h7-8H,1-6H3 |
| InChIKey | OJKUGWNKGOUJFZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |