About tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate
tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate (PubChem CID 134892147) has the molecular formula C10H10F3NO4
and a molecular weight of 265.19 g/mol. Its IUPAC name is tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate |
| PubChem CID | 134892147 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(=O)oc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F3NO4/c1-9(2,3)18-7(16)5-4-6(15)17-8(14-5)10(11,12)13/h4H,1-3H3 |
| InChIKey | ITDIWARAXMKSBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate?
The IUPAC name of tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate (CID 134892147) is tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate.
What is the SMILES notation for tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate?
The canonical SMILES for tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate is CC(C)(C)OC(=O)c1cc(=O)oc(C(F)(F)F)n1.
What is the InChIKey of tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate?
The InChIKey is ITDIWARAXMKSBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO4/c1-9(2,3)18-7(16)5-4-6(15)17-8(14-5)10(11,12)13/h4H,1-3H3.
What are the key properties of tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate?
tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate has a molecular weight of 265.19 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-oxo-2-(trifluoromethyl)-1,3-oxazine-4-carboxylate is sourced from PubChem (CID 134892147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).