C6H9N3O — CID 146155538
(NE)-N-[(1,5-dimethylpyrazol-3-yl)methylidene]hydroxylamine (PubChem CID 146155538) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is (NE)-N-[(1,5-dimethylpyrazol-3-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1,5-dimethylpyrazol-3-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 146155538 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | (NE)-N-[(1,5-dimethylpyrazol-3-yl)methylidene]hydroxylamine |
| SMILES | Cc1cc(/C=N/O)nn1C |
| InChI | InChI=1S/C6H9N3O/c1-5-3-6(4-7-10)8-9(5)2/h3-4,10H,1-2H3/b7-4+ |
| InChIKey | XVKGTGTVJNGHDD-QPJJXVBHSA-N |
| XLogP | 0.54 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|