C11H20ClN3O4Si — CID 153434851
(3Z)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-hydroxy-1,2,5-oxadiazole-3-carboximidoyl chloride (PubChem CID 153434851) has the molecular formula C11H20ClN3O4Si and a molecular weight of 321.84 g/mol. Its IUPAC name is (3Z)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-hydroxy-1,2,5-oxadiazole-3-carboximidoyl chloride.
| Compound Name | (3Z)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-hydroxy-1,2,5-oxadiazole-3-carboximidoyl chloride |
|---|---|
| PubChem CID | 153434851 |
| Molecular Formula | C11H20ClN3O4Si |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (3Z)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-hydroxy-1,2,5-oxadiazole-3-carboximidoyl chloride |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1nonc1/C(Cl)=N/O |
| InChI | InChI=1S/C11H20ClN3O4Si/c1-11(2,3)20(4,5)18-7-6-17-10-8(9(12)13-16)14-19-15-10/h16H,6-7H2,1-5H3/b13-9- |
| InChIKey | RWNWHCNTMMZVAO-LCYFTJDESA-N |
| XLogP | 2.84 |
| TPSA | 89.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|