C12H23N3O5Si — CID 153434877
4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-methoxy-1,2,5-oxadiazole-3-carboxamide (PubChem CID 153434877) has the molecular formula C12H23N3O5Si and a molecular weight of 317.42 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-methoxy-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-methoxy-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 153434877 |
| Molecular Formula | C12H23N3O5Si |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-N-methoxy-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CONC(=O)c1nonc1OCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H23N3O5Si/c1-12(2,3)21(5,6)19-8-7-18-11-9(13-20-15-11)10(16)14-17-4/h7-8H2,1-6H3,(H,14,16) |
| InChIKey | CUVALTDIXXCINN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|